C19H31N5O — CID 75261568
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-pyridin-2-ylpyrazolidine-3-carboxamide (PubChem CID 75261568) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-pyridin-2-ylpyrazolidine-3-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-pyridin-2-ylpyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 75261568 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]-5-pyridin-2-ylpyrazolidine-3-carboxamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)C2CC(c3ccccn3)NN2)C1 |
| InChI | InChI=1S/C19H31N5O/c1-14-10-15(2)13-24(12-14)9-5-8-21-19(25)18-11-17(22-23-18)16-6-3-4-7-20-16/h3-4,6-7,14-15,17-18,22-23H,5,8-13H2,1-2H3,(H,21,25) |
| InChIKey | XRIOGKVMEGEMNI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|