C16H24N6OS — CID 134080613
1-(1,3-benzoxazol-2-yl)-N-[2-(triazolidin-4-ylsulfanyl)ethyl]piperidin-4-amine (PubChem CID 134080613) has the molecular formula C16H24N6OS and a molecular weight of 348.48 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N-[2-(triazolidin-4-ylsulfanyl)ethyl]piperidin-4-amine.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N-[2-(triazolidin-4-ylsulfanyl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 134080613 |
| Molecular Formula | C16H24N6OS |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N-[2-(triazolidin-4-ylsulfanyl)ethyl]piperidin-4-amine |
| SMILES | c1ccc2oc(N3CCC(NCCSC4CNNN4)CC3)nc2c1 |
| InChI | InChI=1S/C16H24N6OS/c1-2-4-14-13(3-1)19-16(23-14)22-8-5-12(6-9-22)17-7-10-24-15-11-18-21-20-15/h1-4,12,15,17-18,20-21H,5-11H2 |
| InChIKey | JKVNGKMGVGIIBR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|