C17H18ClFN2O2 — CID 134086161
1-(3-chloro-4-fluorophenyl)-3-[(Z)-hex-3-enyl]-5-methylpyrazole-4-carboxylic acid (PubChem CID 134086161) has the molecular formula C17H18ClFN2O2 and a molecular weight of 336.79 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[(Z)-hex-3-enyl]-5-methylpyrazole-4-carboxylic acid.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[(Z)-hex-3-enyl]-5-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 134086161 |
| Molecular Formula | C17H18ClFN2O2 |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[(Z)-hex-3-enyl]-5-methylpyrazole-4-carboxylic acid |
| SMILES | CC/C=C\CCc1nn(-c2ccc(F)c(Cl)c2)c(C)c1C(=O)O |
| InChI | InChI=1S/C17H18ClFN2O2/c1-3-4-5-6-7-15-16(17(22)23)11(2)21(20-15)12-8-9-14(19)13(18)10-12/h4-5,8-10H,3,6-7H2,1-2H3,(H,22,23)/b5-4- |
| InChIKey | JVNQYKRBJMCFHB-PLNGDYQASA-N |
| XLogP | 4.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|