C18H20Cl2N2O2 — CID 134086144
1-(2,5-dichlorophenyl)-5-ethyl-3-[(Z)-hex-3-enyl]pyrazole-4-carboxylic acid (PubChem CID 134086144) has the molecular formula C18H20Cl2N2O2 and a molecular weight of 367.28 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-5-ethyl-3-[(Z)-hex-3-enyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-(2,5-dichlorophenyl)-5-ethyl-3-[(Z)-hex-3-enyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 134086144 |
| Molecular Formula | C18H20Cl2N2O2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-5-ethyl-3-[(Z)-hex-3-enyl]pyrazole-4-carboxylic acid |
| SMILES | CC/C=C\CCc1nn(-c2cc(Cl)ccc2Cl)c(CC)c1C(=O)O |
| InChI | InChI=1S/C18H20Cl2N2O2/c1-3-5-6-7-8-14-17(18(23)24)15(4-2)22(21-14)16-11-12(19)9-10-13(16)20/h5-6,9-11H,3-4,7-8H2,1-2H3,(H,23,24)/b6-5- |
| InChIKey | DMQVHNTZIPVGTM-WAYWQWQTSA-N |
| XLogP | 5.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|