C19H22Cl2N2O2 — CID 3690605
1-(2,5-dichlorophenyl)-3-hex-3-enyl-5-propan-2-ylpyrazole-4-carboxylic acid (PubChem CID 3690605) has the molecular formula C19H22Cl2N2O2 and a molecular weight of 381.30 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-hex-3-enyl-5-propan-2-ylpyrazole-4-carboxylic acid.
| Compound Name | 1-(2,5-dichlorophenyl)-3-hex-3-enyl-5-propan-2-ylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 3690605 |
| Molecular Formula | C19H22Cl2N2O2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-hex-3-enyl-5-propan-2-ylpyrazole-4-carboxylic acid |
| SMILES | CCC=CCCc1nn(-c2cc(Cl)ccc2Cl)c(C(C)C)c1C(=O)O |
| InChI | InChI=1S/C19H22Cl2N2O2/c1-4-5-6-7-8-15-17(19(24)25)18(12(2)3)23(22-15)16-11-13(20)9-10-14(16)21/h5-6,9-12H,4,7-8H2,1-3H3,(H,24,25) |
| InChIKey | MAYHFGKQTQHBCL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|