C18H14Cl2N2O2 — CID 3344991
1-(2,5-dichlorophenyl)-3-ethyl-5-phenylpyrazole-4-carboxylic acid (PubChem CID 3344991) has the molecular formula C18H14Cl2N2O2 and a molecular weight of 361.23 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-ethyl-5-phenylpyrazole-4-carboxylic acid.
| Compound Name | 1-(2,5-dichlorophenyl)-3-ethyl-5-phenylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 3344991 |
| Molecular Formula | C18H14Cl2N2O2 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-ethyl-5-phenylpyrazole-4-carboxylic acid |
| SMILES | CCc1nn(-c2cc(Cl)ccc2Cl)c(-c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C18H14Cl2N2O2/c1-2-14-16(18(23)24)17(11-6-4-3-5-7-11)22(21-14)15-10-12(19)8-9-13(15)20/h3-10H,2H2,1H3,(H,23,24) |
| InChIKey | GQWPRLUPNZDYKL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |