C15H11Cl2N3O — CID 18385345
2-(2,5-dichlorophenyl)-4-methyl-5-phenyl-1,2,4-triazol-3-one (PubChem CID 18385345) has the molecular formula C15H11Cl2N3O and a molecular weight of 320.18 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-4-methyl-5-phenyl-1,2,4-triazol-3-one.
| Compound Name | 2-(2,5-dichlorophenyl)-4-methyl-5-phenyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 18385345 |
| Molecular Formula | C15H11Cl2N3O |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-4-methyl-5-phenyl-1,2,4-triazol-3-one |
| SMILES | Cn1c(-c2ccccc2)nn(-c2cc(Cl)ccc2Cl)c1=O |
| InChI | InChI=1S/C15H11Cl2N3O/c1-19-14(10-5-3-2-4-6-10)18-20(15(19)21)13-9-11(16)7-8-12(13)17/h2-9H,1H3 |
| InChIKey | RRTDTVMSBBVMFX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |