C16H11Cl2NO2S — CID 102586846
2-(2,5-dichlorophenyl)-5-methyl-1-oxo-4-phenyl-1,2-thiazol-3-one (PubChem CID 102586846) has the molecular formula C16H11Cl2NO2S and a molecular weight of 352.24 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-5-methyl-1-oxo-4-phenyl-1,2-thiazol-3-one.
| Compound Name | 2-(2,5-dichlorophenyl)-5-methyl-1-oxo-4-phenyl-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 102586846 |
| Molecular Formula | C16H11Cl2NO2S |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-5-methyl-1-oxo-4-phenyl-1,2-thiazol-3-one |
| SMILES | CC1=C(c2ccccc2)C(=O)N(c2cc(Cl)ccc2Cl)S1=O |
| InChI | InChI=1S/C16H11Cl2NO2S/c1-10-15(11-5-3-2-4-6-11)16(20)19(22(10)21)14-9-12(17)7-8-13(14)18/h2-9H,1H3 |
| InChIKey | XIZGNGPCQXAZEH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |