C15H19Cl3N2S — CID 134087727
3-(4-chloro-2-methylphenyl)-1-[(2,2-dichlorocyclopropyl)methyl]-1-propan-2-ylthiourea (PubChem CID 134087727) has the molecular formula C15H19Cl3N2S and a molecular weight of 365.76 g/mol. Its IUPAC name is 3-(4-chloro-2-methylphenyl)-1-[(2,2-dichlorocyclopropyl)methyl]-1-propan-2-ylthiourea.
| Compound Name | 3-(4-chloro-2-methylphenyl)-1-[(2,2-dichlorocyclopropyl)methyl]-1-propan-2-ylthiourea |
|---|---|
| PubChem CID | 134087727 |
| Molecular Formula | C15H19Cl3N2S |
| Molecular Weight | 365.76 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 3-(4-chloro-2-methylphenyl)-1-[(2,2-dichlorocyclopropyl)methyl]-1-propan-2-ylthiourea |
| SMILES | Cc1cc(Cl)ccc1NC(=S)N(CC1CC1(Cl)Cl)C(C)C |
| InChI | InChI=1S/C15H19Cl3N2S/c1-9(2)20(8-11-7-15(11,17)18)14(21)19-13-5-4-12(16)6-10(13)3/h4-6,9,11H,7-8H2,1-3H3,(H,19,21) |
| InChIKey | OFWIIOVXJNEODZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.76 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|