C15H9F2N3O2 — CID 134088027
1-(3,4-difluorophenyl)-5-imino-3-phenylimidazolidine-2,4-dione (PubChem CID 134088027) has the molecular formula C15H9F2N3O2 and a molecular weight of 301.25 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-5-imino-3-phenylimidazolidine-2,4-dione.
| Compound Name | 1-(3,4-difluorophenyl)-5-imino-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134088027 |
| Molecular Formula | C15H9F2N3O2 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-(3,4-difluorophenyl)-5-imino-3-phenylimidazolidine-2,4-dione |
| SMILES | [H]/N=C1\C(=O)N(c2ccccc2)C(=O)N1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H9F2N3O2/c16-11-7-6-10(8-12(11)17)19-13(18)14(21)20(15(19)22)9-4-2-1-3-5-9/h1-8,18H/b18-13+ |
| InChIKey | KVKGVDVJGOMHRT-QGOAFFKASA-N |
| XLogP | 2.92 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|