About 4-aminobenzene-1,3-diol;hydrochloride
4-aminobenzene-1,3-diol;hydrochloride (PubChem CID 13408822) has the molecular formula C6H8ClNO2
and a molecular weight of 161.59 g/mol. Its IUPAC name is 4-aminobenzene-1,3-diol;hydrochloride.
Molecular Properties
| Compound Name | 4-aminobenzene-1,3-diol;hydrochloride |
| PubChem CID | 13408822 |
| Molecular Formula | C6H8ClNO2 |
| Molecular Weight | 161.59 g/mol |
| Exact Mass | 161.02 |
| IUPAC Name | 4-aminobenzene-1,3-diol;hydrochloride |
| SMILES | Cl.Nc1ccc(O)cc1O |
| InChI | InChI=1S/C6H7NO2.ClH/c7-5-2-1-4(8)3-6(5)9;/h1-3,8-9H,7H2;1H |
| InChIKey | LLJMPRKYLLJAEB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.59 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzene-1,3-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzene-1,3-diol;hydrochloride?
The IUPAC name of 4-aminobenzene-1,3-diol;hydrochloride (CID 13408822) is 4-aminobenzene-1,3-diol;hydrochloride.
What is the SMILES notation for 4-aminobenzene-1,3-diol;hydrochloride?
The canonical SMILES for 4-aminobenzene-1,3-diol;hydrochloride is Cl.Nc1ccc(O)cc1O.
What is the InChIKey of 4-aminobenzene-1,3-diol;hydrochloride?
The InChIKey is LLJMPRKYLLJAEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2.ClH/c7-5-2-1-4(8)3-6(5)9;/h1-3,8-9H,7H2;1H.
What are the key properties of 4-aminobenzene-1,3-diol;hydrochloride?
4-aminobenzene-1,3-diol;hydrochloride has a molecular weight of 161.59 g/mol, XLogP of 1.10, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzene-1,3-diol;hydrochloride is sourced from PubChem (CID 13408822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).