C20H34N2O — CID 134088576
3-cyclohexyl-1-[(4-prop-1-en-2-ylcyclohexen-1-yl)methyl]-1-propylurea (PubChem CID 134088576) has the molecular formula C20H34N2O and a molecular weight of 318.51 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(4-prop-1-en-2-ylcyclohexen-1-yl)methyl]-1-propylurea.
| Compound Name | 3-cyclohexyl-1-[(4-prop-1-en-2-ylcyclohexen-1-yl)methyl]-1-propylurea |
|---|---|
| PubChem CID | 134088576 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | 3-cyclohexyl-1-[(4-prop-1-en-2-ylcyclohexen-1-yl)methyl]-1-propylurea |
| SMILES | C=C(C)C1CC=C(CN(CCC)C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C20H34N2O/c1-4-14-22(20(23)21-19-8-6-5-7-9-19)15-17-10-12-18(13-11-17)16(2)3/h10,18-19H,2,4-9,11-15H2,1,3H3,(H,21,23) |
| InChIKey | QTRJWCSAKSOZJS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|