C21H36N2O — CID 42698096
1-butyl-3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]urea (PubChem CID 42698096) has the molecular formula C21H36N2O and a molecular weight of 332.53 g/mol. Its IUPAC name is 1-butyl-3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]urea.
| Compound Name | 1-butyl-3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]urea |
|---|---|
| PubChem CID | 42698096 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | 1-butyl-3-cyclohexyl-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]urea |
| SMILES | CCCCN(CC1=CCC2CC1C2(C)C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C21H36N2O/c1-4-5-13-23(20(24)22-18-9-7-6-8-10-18)15-16-11-12-17-14-19(16)21(17,2)3/h11,17-19H,4-10,12-15H2,1-3H3,(H,22,24) |
| InChIKey | BHFQWFNOPNWSTB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|