C21H24Cl2NO5+ — CID 13408964
[5-[2,3-dichloro-4-(2-ethoxy-2-oxoethoxy)benzoyl]-2-hydroxyphenyl]methyl-trimethylazanium (PubChem CID 13408964) has the molecular formula C21H24Cl2NO5+ and a molecular weight of 441.33 g/mol. Its IUPAC name is [5-[2,3-dichloro-4-(2-ethoxy-2-oxoethoxy)benzoyl]-2-hydroxyphenyl]methyl-trimethylazanium.
| Compound Name | [5-[2,3-dichloro-4-(2-ethoxy-2-oxoethoxy)benzoyl]-2-hydroxyphenyl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 13408964 |
| Molecular Formula | C21H24Cl2NO5+ |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [5-[2,3-dichloro-4-(2-ethoxy-2-oxoethoxy)benzoyl]-2-hydroxyphenyl]methyl-trimethylazanium |
| SMILES | CCOC(=O)COc1ccc(C(=O)c2ccc(O)c(C[N+](C)(C)C)c2)c(Cl)c1Cl |
| InChI | InChI=1S/C21H23Cl2NO5/c1-5-28-18(26)12-29-17-9-7-15(19(22)20(17)23)21(27)13-6-8-16(25)14(10-13)11-24(2,3)4/h6-10H,5,11-12H2,1-4H3/p+1 |
| InChIKey | BBZWUZUJYYIDFV-UHFFFAOYSA-O |
| XLogP | 4.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|