C14H16Cl2O4 — CID 169438211
ethyl 2-[2,3-dichloro-4-(2,2,3,3,4,4,4-heptadeuteriobutanoyl)phenoxy]acetate (PubChem CID 169438211) has the molecular formula C14H16Cl2O4 and a molecular weight of 326.23 g/mol. Its IUPAC name is ethyl 2-[2,3-dichloro-4-(2,2,3,3,4,4,4-heptadeuteriobutanoyl)phenoxy]acetate.
| Compound Name | ethyl 2-[2,3-dichloro-4-(2,2,3,3,4,4,4-heptadeuteriobutanoyl)phenoxy]acetate |
|---|---|
| PubChem CID | 169438211 |
| Molecular Formula | C14H16Cl2O4 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | ethyl 2-[2,3-dichloro-4-(2,2,3,3,4,4,4-heptadeuteriobutanoyl)phenoxy]acetate |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)c1ccc(OCC(=O)OCC)c(Cl)c1Cl |
| InChI | InChI=1S/C14H16Cl2O4/c1-3-5-10(17)9-6-7-11(14(16)13(9)15)20-8-12(18)19-4-2/h6-7H,3-5,8H2,1-2H3/i1D3,3D2,5D2 |
| InChIKey | PBVGBFWAEFWKMK-HJHJEWFGSA-N |
| XLogP | 3.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |