C20H21Cl2NO5 — CID 12854005
ethyl 2-[2,3-dichloro-4-[3-[(dimethylamino)methyl]-4-hydroxybenzoyl]phenoxy]acetate (PubChem CID 12854005) has the molecular formula C20H21Cl2NO5 and a molecular weight of 426.30 g/mol. Its IUPAC name is ethyl 2-[2,3-dichloro-4-[3-[(dimethylamino)methyl]-4-hydroxybenzoyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,3-dichloro-4-[3-[(dimethylamino)methyl]-4-hydroxybenzoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 12854005 |
| Molecular Formula | C20H21Cl2NO5 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | ethyl 2-[2,3-dichloro-4-[3-[(dimethylamino)methyl]-4-hydroxybenzoyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C(=O)c2ccc(O)c(CN(C)C)c2)c(Cl)c1Cl |
| InChI | InChI=1S/C20H21Cl2NO5/c1-4-27-17(25)11-28-16-8-6-14(18(21)19(16)22)20(26)12-5-7-15(24)13(9-12)10-23(2)3/h5-9,24H,4,10-11H2,1-3H3 |
| InChIKey | KXVGJDPIJCJCFK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|