C27H32Cl2N2O5 — CID 12854033
2-[2,3-dichloro-4-[4-hydroxy-3,5-bis(piperidin-1-ylmethyl)benzoyl]phenoxy]acetic acid (PubChem CID 12854033) has the molecular formula C27H32Cl2N2O5 and a molecular weight of 535.47 g/mol. Its IUPAC name is 2-[2,3-dichloro-4-[4-hydroxy-3,5-bis(piperidin-1-ylmethyl)benzoyl]phenoxy]acetic acid.
| Compound Name | 2-[2,3-dichloro-4-[4-hydroxy-3,5-bis(piperidin-1-ylmethyl)benzoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 12854033 |
| Molecular Formula | C27H32Cl2N2O5 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 2-[2,3-dichloro-4-[4-hydroxy-3,5-bis(piperidin-1-ylmethyl)benzoyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C(=O)c2cc(CN3CCCCC3)c(O)c(CN3CCCCC3)c2)c(Cl)c1Cl |
| InChI | InChI=1S/C27H32Cl2N2O5/c28-24-21(7-8-22(25(24)29)36-17-23(32)33)27(35)18-13-19(15-30-9-3-1-4-10-30)26(34)20(14-18)16-31-11-5-2-6-12-31/h7-8,13-14,34H,1-6,9-12,15-17H2,(H,32,33) |
| InChIKey | HUAZHOXRAOAYHY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|