C13H12Cl2O4 — CID 70453603
2-[2,3-dichloro-4-(3-methylbut-2-enoyl)phenoxy]acetic acid (PubChem CID 70453603) has the molecular formula C13H12Cl2O4 and a molecular weight of 303.14 g/mol. Its IUPAC name is 2-[2,3-dichloro-4-(3-methylbut-2-enoyl)phenoxy]acetic acid.
| Compound Name | 2-[2,3-dichloro-4-(3-methylbut-2-enoyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 70453603 |
| Molecular Formula | C13H12Cl2O4 |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-[2,3-dichloro-4-(3-methylbut-2-enoyl)phenoxy]acetic acid |
| SMILES | CC(C)=CC(=O)c1ccc(OCC(=O)O)c(Cl)c1Cl |
| InChI | InChI=1S/C13H12Cl2O4/c1-7(2)5-9(16)8-3-4-10(13(15)12(8)14)19-6-11(17)18/h3-5H,6H2,1-2H3,(H,17,18) |
| InChIKey | XWQZYUAKKVGGKA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|