C18H14Cl2O6S — CID 90679206
2-[4-[(Z)-2-(benzenesulfonyl)-3-oxobut-1-enyl]-2,3-dichlorophenoxy]acetic acid (PubChem CID 90679206) has the molecular formula C18H14Cl2O6S and a molecular weight of 429.28 g/mol. Its IUPAC name is 2-[4-[(Z)-2-(benzenesulfonyl)-3-oxobut-1-enyl]-2,3-dichlorophenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-2-(benzenesulfonyl)-3-oxobut-1-enyl]-2,3-dichlorophenoxy]acetic acid |
|---|---|
| PubChem CID | 90679206 |
| Molecular Formula | C18H14Cl2O6S |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 2-[4-[(Z)-2-(benzenesulfonyl)-3-oxobut-1-enyl]-2,3-dichlorophenoxy]acetic acid |
| SMILES | CC(=O)/C(=C/c1ccc(OCC(=O)O)c(Cl)c1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H14Cl2O6S/c1-11(21)15(27(24,25)13-5-3-2-4-6-13)9-12-7-8-14(18(20)17(12)19)26-10-16(22)23/h2-9H,10H2,1H3,(H,22,23)/b15-9- |
| InChIKey | IQUWNZHEEXFRFO-DHDCSXOGSA-N |
| XLogP | 3.86 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|