C12H11Cl2NO5 — CID 67914060
3-[2,3-dichloro-4-[(Z)-2-nitroprop-1-enyl]phenoxy]propanoic acid (PubChem CID 67914060) has the molecular formula C12H11Cl2NO5 and a molecular weight of 320.13 g/mol. Its IUPAC name is 3-[2,3-dichloro-4-[(Z)-2-nitroprop-1-enyl]phenoxy]propanoic acid.
| Compound Name | 3-[2,3-dichloro-4-[(Z)-2-nitroprop-1-enyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 67914060 |
| Molecular Formula | C12H11Cl2NO5 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 3-[2,3-dichloro-4-[(Z)-2-nitroprop-1-enyl]phenoxy]propanoic acid |
| SMILES | C/C(=C/c1ccc(OCCC(=O)O)c(Cl)c1Cl)[N+](=O)[O-] |
| InChI | InChI=1S/C12H11Cl2NO5/c1-7(15(18)19)6-8-2-3-9(12(14)11(8)13)20-5-4-10(16)17/h2-3,6H,4-5H2,1H3,(H,16,17)/b7-6- |
| InChIKey | WELZRTARPAAYAH-SREVYHEPSA-N |
| XLogP | 3.48 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|