C14H14Cl2NNaO5 — CID 86742221
sodium 4-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]butanoate (PubChem CID 86742221) has the molecular formula C14H14Cl2NNaO5 and a molecular weight of 370.16 g/mol. Its IUPAC name is sodium 4-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]butanoate.
| Compound Name | sodium 4-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 86742221 |
| Molecular Formula | C14H14Cl2NNaO5 |
| Molecular Weight | 370.16 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | sodium 4-[2,3-dichloro-4-[(E)-2-nitrobut-1-enyl]phenoxy]butanoate |
| SMILES | CC/C(=C\c1ccc(OCCCC(=O)[O-])c(Cl)c1Cl)[N+](=O)[O-].[Na+] |
| InChI | InChI=1S/C14H15Cl2NO5.Na/c1-2-10(17(20)21)8-9-5-6-11(14(16)13(9)15)22-7-3-4-12(18)19;/h5-6,8H,2-4,7H2,1H3,(H,18,19);/q;+1/p-1/b10-8+; |
| InChIKey | CVLBEEHXMKLEAZ-VRTOBVRTSA-M |
| XLogP | -0.07 |
| TPSA | 92.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.16 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|