C17H11Cl3O5 — CID 91222796
2-[3-(carboxymethoxy)-2,6-dichlorophenyl]-3-(2-chlorophenyl)prop-2-enoic acid (PubChem CID 91222796) has the molecular formula C17H11Cl3O5 and a molecular weight of 401.63 g/mol. Its IUPAC name is 2-[3-(carboxymethoxy)-2,6-dichlorophenyl]-3-(2-chlorophenyl)prop-2-enoic acid.
| Compound Name | 2-[3-(carboxymethoxy)-2,6-dichlorophenyl]-3-(2-chlorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 91222796 |
| Molecular Formula | C17H11Cl3O5 |
| Molecular Weight | 401.63 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 2-[3-(carboxymethoxy)-2,6-dichlorophenyl]-3-(2-chlorophenyl)prop-2-enoic acid |
| SMILES | O=C(O)COc1ccc(Cl)c(C(=Cc2ccccc2Cl)C(=O)O)c1Cl |
| InChI | InChI=1S/C17H11Cl3O5/c18-11-4-2-1-3-9(11)7-10(17(23)24)15-12(19)5-6-13(16(15)20)25-8-14(21)22/h1-7H,8H2,(H,21,22)(H,23,24) |
| InChIKey | KERQHLKWRKZWHI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.63 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|