C20H24Cl2O8 — CID 10766508
2-[2,3-dichloro-4-(5-ethoxy-4-ethoxycarbonyl-2-ethyl-5-oxopentanoyl)phenoxy]acetic acid (PubChem CID 10766508) has the molecular formula C20H24Cl2O8 and a molecular weight of 463.31 g/mol. Its IUPAC name is 2-[2,3-dichloro-4-(5-ethoxy-4-ethoxycarbonyl-2-ethyl-5-oxopentanoyl)phenoxy]acetic acid.
| Compound Name | 2-[2,3-dichloro-4-(5-ethoxy-4-ethoxycarbonyl-2-ethyl-5-oxopentanoyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 10766508 |
| Molecular Formula | C20H24Cl2O8 |
| Molecular Weight | 463.31 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 2-[2,3-dichloro-4-(5-ethoxy-4-ethoxycarbonyl-2-ethyl-5-oxopentanoyl)phenoxy]acetic acid |
| SMILES | CCOC(=O)C(CC(CC)C(=O)c1ccc(OCC(=O)O)c(Cl)c1Cl)C(=O)OCC |
| InChI | InChI=1S/C20H24Cl2O8/c1-4-11(9-13(19(26)28-5-2)20(27)29-6-3)18(25)12-7-8-14(17(22)16(12)21)30-10-15(23)24/h7-8,11,13H,4-6,9-10H2,1-3H3,(H,23,24) |
| InChIKey | YADRTPJTKIHWEV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|