C23H17Cl2FN2O — CID 134090751
(3,5-dichlorophenyl)-[4-(4-fluorophenyl)imino-2-methyl-2,3-dihydroquinolin-1-yl]methanone (PubChem CID 134090751) has the molecular formula C23H17Cl2FN2O and a molecular weight of 427.31 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-[4-(4-fluorophenyl)imino-2-methyl-2,3-dihydroquinolin-1-yl]methanone.
| Compound Name | (3,5-dichlorophenyl)-[4-(4-fluorophenyl)imino-2-methyl-2,3-dihydroquinolin-1-yl]methanone |
|---|---|
| PubChem CID | 134090751 |
| Molecular Formula | C23H17Cl2FN2O |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | (3,5-dichlorophenyl)-[4-(4-fluorophenyl)imino-2-methyl-2,3-dihydroquinolin-1-yl]methanone |
| SMILES | CC1C/C(=N\c2ccc(F)cc2)c2ccccc2N1C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H17Cl2FN2O/c1-14-10-21(27-19-8-6-18(26)7-9-19)20-4-2-3-5-22(20)28(14)23(29)15-11-16(24)13-17(25)12-15/h2-9,11-14H,10H2,1H3/b27-21+ |
| InChIKey | VZUKJGCAVQMEJT-SZXQPVLSSA-N |
| XLogP | 6.69 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|