C17H13ClFNO2 — CID 134125548
8-chloro-1-(4-fluorobenzoyl)-2-methyl-2,3-dihydroquinolin-4-one (PubChem CID 134125548) has the molecular formula C17H13ClFNO2 and a molecular weight of 317.75 g/mol. Its IUPAC name is 8-chloro-1-(4-fluorobenzoyl)-2-methyl-2,3-dihydroquinolin-4-one.
| Compound Name | 8-chloro-1-(4-fluorobenzoyl)-2-methyl-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 134125548 |
| Molecular Formula | C17H13ClFNO2 |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 8-chloro-1-(4-fluorobenzoyl)-2-methyl-2,3-dihydroquinolin-4-one |
| SMILES | CC1CC(=O)c2cccc(Cl)c2N1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13ClFNO2/c1-10-9-15(21)13-3-2-4-14(18)16(13)20(10)17(22)11-5-7-12(19)8-6-11/h2-8,10H,9H2,1H3 |
| InChIKey | NYUNDYVCFCSNBU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |