C23H17ClF2N2O — CID 134125547
[5-chloro-4-(4-fluorophenyl)imino-2-methyl-2,3-dihydroquinolin-1-yl]-(4-fluorophenyl)methanone (PubChem CID 134125547) has the molecular formula C23H17ClF2N2O and a molecular weight of 410.85 g/mol. Its IUPAC name is [5-chloro-4-(4-fluorophenyl)imino-2-methyl-2,3-dihydroquinolin-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [5-chloro-4-(4-fluorophenyl)imino-2-methyl-2,3-dihydroquinolin-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 134125547 |
| Molecular Formula | C23H17ClF2N2O |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | [5-chloro-4-(4-fluorophenyl)imino-2-methyl-2,3-dihydroquinolin-1-yl]-(4-fluorophenyl)methanone |
| SMILES | CC1C/C(=N\c2ccc(F)cc2)c2c(Cl)cccc2N1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H17ClF2N2O/c1-14-13-20(27-18-11-9-17(26)10-12-18)22-19(24)3-2-4-21(22)28(14)23(29)15-5-7-16(25)8-6-15/h2-12,14H,13H2,1H3/b27-20+ |
| InChIKey | GZNACYZBHPJEFS-NHFJDJAPSA-N |
| XLogP | 6.18 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|