C17H12F2INO2 — CID 134106081
6-fluoro-1-(3-fluoro-4-iodobenzoyl)-2-methyl-2,3-dihydroquinolin-4-one (PubChem CID 134106081) has the molecular formula C17H12F2INO2 and a molecular weight of 427.19 g/mol. Its IUPAC name is 6-fluoro-1-(3-fluoro-4-iodobenzoyl)-2-methyl-2,3-dihydroquinolin-4-one.
| Compound Name | 6-fluoro-1-(3-fluoro-4-iodobenzoyl)-2-methyl-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 134106081 |
| Molecular Formula | C17H12F2INO2 |
| Molecular Weight | 427.19 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | 6-fluoro-1-(3-fluoro-4-iodobenzoyl)-2-methyl-2,3-dihydroquinolin-4-one |
| SMILES | CC1CC(=O)c2cc(F)ccc2N1C(=O)c1ccc(I)c(F)c1 |
| InChI | InChI=1S/C17H12F2INO2/c1-9-6-16(22)12-8-11(18)3-5-15(12)21(9)17(23)10-2-4-14(20)13(19)7-10/h2-5,7-9H,6H2,1H3 |
| InChIKey | YQKWKLLCPGEZPH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|