C17H9F5N2O4 — CID 134101831
6-fluoro-1-(3-fluoro-4-nitrobenzoyl)-2-(trifluoromethyl)-2,3-dihydroquinolin-4-one (PubChem CID 134101831) has the molecular formula C17H9F5N2O4 and a molecular weight of 400.26 g/mol. Its IUPAC name is 6-fluoro-1-(3-fluoro-4-nitrobenzoyl)-2-(trifluoromethyl)-2,3-dihydroquinolin-4-one.
| Compound Name | 6-fluoro-1-(3-fluoro-4-nitrobenzoyl)-2-(trifluoromethyl)-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 134101831 |
| Molecular Formula | C17H9F5N2O4 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 6-fluoro-1-(3-fluoro-4-nitrobenzoyl)-2-(trifluoromethyl)-2,3-dihydroquinolin-4-one |
| SMILES | O=C1CC(C(F)(F)F)N(C(=O)c2ccc([N+](=O)[O-])c(F)c2)c2ccc(F)cc21 |
| InChI | InChI=1S/C17H9F5N2O4/c18-9-2-4-12-10(6-9)14(25)7-15(17(20,21)22)23(12)16(26)8-1-3-13(24(27)28)11(19)5-8/h1-6,15H,7H2 |
| InChIKey | BJMLRKDETGWGMN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|