C23H13F6N3O3 — CID 134101834
[6-fluoro-4-(4-fluorophenyl)imino-2-(trifluoromethyl)-2,3-dihydroquinolin-1-yl]-(3-fluoro-4-nitrophenyl)methanone (PubChem CID 134101834) has the molecular formula C23H13F6N3O3 and a molecular weight of 493.36 g/mol. Its IUPAC name is [6-fluoro-4-(4-fluorophenyl)imino-2-(trifluoromethyl)-2,3-dihydroquinolin-1-yl]-(3-fluoro-4-nitrophenyl)methanone.
| Compound Name | [6-fluoro-4-(4-fluorophenyl)imino-2-(trifluoromethyl)-2,3-dihydroquinolin-1-yl]-(3-fluoro-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 134101834 |
| Molecular Formula | C23H13F6N3O3 |
| Molecular Weight | 493.36 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | [6-fluoro-4-(4-fluorophenyl)imino-2-(trifluoromethyl)-2,3-dihydroquinolin-1-yl]-(3-fluoro-4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])c(F)c1)N1c2ccc(F)cc2/C(=N/c2ccc(F)cc2)CC1C(F)(F)F |
| InChI | InChI=1S/C23H13F6N3O3/c24-13-2-5-15(6-3-13)30-18-11-21(23(27,28)29)31(19-8-4-14(25)10-16(18)19)22(33)12-1-7-20(32(34)35)17(26)9-12/h1-10,21H,11H2/b30-18+ |
| InChIKey | HCIJYUBXLLHJOI-UXHLAJHPSA-N |
| XLogP | 6.11 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.36 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|