C25H36N4 — CID 134091999
N'-(6-aminohexyl)-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 134091999) has the molecular formula C25H36N4 and a molecular weight of 392.59 g/mol. Its IUPAC name is N'-(6-aminohexyl)-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N'-(6-aminohexyl)-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 134091999 |
| Molecular Formula | C25H36N4 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | N'-(6-aminohexyl)-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | Cc1cc(C)c(N/C(=N/CCCCCCN)N2CCc3ccccc3C2)c(C)c1 |
| InChI | InChI=1S/C25H36N4/c1-19-16-20(2)24(21(3)17-19)28-25(27-14-9-5-4-8-13-26)29-15-12-22-10-6-7-11-23(22)18-29/h6-7,10-11,16-17H,4-5,8-9,12-15,18,26H2,1-3H3,(H,27,28) |
| InChIKey | PEGJOHVVYUWESN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|