C20H25FN4S — CID 134099407
N'-[2-(2-aminoethylsulfanyl)ethyl]-N-(3-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 134099407) has the molecular formula C20H25FN4S and a molecular weight of 372.51 g/mol. Its IUPAC name is N'-[2-(2-aminoethylsulfanyl)ethyl]-N-(3-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N'-[2-(2-aminoethylsulfanyl)ethyl]-N-(3-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 134099407 |
| Molecular Formula | C20H25FN4S |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N'-[2-(2-aminoethylsulfanyl)ethyl]-N-(3-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | NCCSCC/N=C(/Nc1cccc(F)c1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H25FN4S/c21-18-6-3-7-19(14-18)24-20(23-10-13-26-12-9-22)25-11-8-16-4-1-2-5-17(16)15-25/h1-7,14H,8-13,15,22H2,(H,23,24) |
| InChIKey | DPSFKPWAGTXJBG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|