C17H16ClO4- — CID 134092725
5-(4-chlorophenyl)-2-(2,4-dioxopentan-3-yl)-3-oxocyclohexen-1-olate (PubChem CID 134092725) has the molecular formula C17H16ClO4- and a molecular weight of 319.76 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-(2,4-dioxopentan-3-yl)-3-oxocyclohexen-1-olate.
| Compound Name | 5-(4-chlorophenyl)-2-(2,4-dioxopentan-3-yl)-3-oxocyclohexen-1-olate |
|---|---|
| PubChem CID | 134092725 |
| Molecular Formula | C17H16ClO4- |
| Molecular Weight | 319.76 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 5-(4-chlorophenyl)-2-(2,4-dioxopentan-3-yl)-3-oxocyclohexen-1-olate |
| SMILES | CC(=O)C(C(C)=O)C1=C([O-])CC(c2ccc(Cl)cc2)CC1=O |
| InChI | InChI=1S/C17H17ClO4/c1-9(19)16(10(2)20)17-14(21)7-12(8-15(17)22)11-3-5-13(18)6-4-11/h3-6,12,16,21H,7-8H2,1-2H3/p-1 |
| InChIKey | XIKPRNIAGRVUOE-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.76 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|