C14H13ClNO3- — CID 137279005
5-(4-chlorophenyl)-2-[(Z)-[methyl(oxido)azaniumylidene]methyl]-3-oxocyclohexen-1-olate (PubChem CID 137279005) has the molecular formula C14H13ClNO3- and a molecular weight of 278.72 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[(Z)-[methyl(oxido)azaniumylidene]methyl]-3-oxocyclohexen-1-olate.
| Compound Name | 5-(4-chlorophenyl)-2-[(Z)-[methyl(oxido)azaniumylidene]methyl]-3-oxocyclohexen-1-olate |
|---|---|
| PubChem CID | 137279005 |
| Molecular Formula | C14H13ClNO3- |
| Molecular Weight | 278.72 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[(Z)-[methyl(oxido)azaniumylidene]methyl]-3-oxocyclohexen-1-olate |
| SMILES | C/[N+]([O-])=C/C1=C([O-])CC(c2ccc(Cl)cc2)CC1=O |
| InChI | InChI=1S/C14H14ClNO3/c1-16(19)8-12-13(17)6-10(7-14(12)18)9-2-4-11(15)5-3-9/h2-5,8,10,17H,6-7H2,1H3/p-1/b16-8- |
| InChIKey | GGPZBRNPYGLITP-PXNMLYILSA-M |
| XLogP | 1.61 |
| TPSA | 66.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.72 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|