C22H18BrCl2N3O — CID 134093000
1-[2-(4-bromophenyl)ethyl]-3-(4-chlorophenyl)-1-[(E)-(4-chlorophenyl)methylideneamino]urea (PubChem CID 134093000) has the molecular formula C22H18BrCl2N3O and a molecular weight of 491.22 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)ethyl]-3-(4-chlorophenyl)-1-[(E)-(4-chlorophenyl)methylideneamino]urea.
| Compound Name | 1-[2-(4-bromophenyl)ethyl]-3-(4-chlorophenyl)-1-[(E)-(4-chlorophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 134093000 |
| Molecular Formula | C22H18BrCl2N3O |
| Molecular Weight | 491.22 g/mol |
| Exact Mass | 489.00 |
| IUPAC Name | 1-[2-(4-bromophenyl)ethyl]-3-(4-chlorophenyl)-1-[(E)-(4-chlorophenyl)methylideneamino]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)N(CCc1ccc(Br)cc1)/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18BrCl2N3O/c23-18-5-1-16(2-6-18)13-14-28(26-15-17-3-7-19(24)8-4-17)22(29)27-21-11-9-20(25)10-12-21/h1-12,15H,13-14H2,(H,27,29)/b26-15+ |
| InChIKey | OSBBVQXTCXGVGF-CVKSISIWSA-N |
| XLogP | 6.87 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.22 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|