C13H15ClF3N3O2 — CID 134111023
3-(4-chlorophenyl)-1-(2-hydroxyethyl)-1-[(E)-(3,3,3-trifluoro-2-methylpropylidene)amino]urea (PubChem CID 134111023) has the molecular formula C13H15ClF3N3O2 and a molecular weight of 337.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(2-hydroxyethyl)-1-[(E)-(3,3,3-trifluoro-2-methylpropylidene)amino]urea.
| Compound Name | 3-(4-chlorophenyl)-1-(2-hydroxyethyl)-1-[(E)-(3,3,3-trifluoro-2-methylpropylidene)amino]urea |
|---|---|
| PubChem CID | 134111023 |
| Molecular Formula | C13H15ClF3N3O2 |
| Molecular Weight | 337.73 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(2-hydroxyethyl)-1-[(E)-(3,3,3-trifluoro-2-methylpropylidene)amino]urea |
| SMILES | CC(/C=N/N(CCO)C(=O)Nc1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H15ClF3N3O2/c1-9(13(15,16)17)8-18-20(6-7-21)12(22)19-11-4-2-10(14)3-5-11/h2-5,8-9,21H,6-7H2,1H3,(H,19,22)/b18-8+ |
| InChIKey | HMEVVKFTQGAWAT-QGMBQPNBSA-N |
| XLogP | 3.35 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.73 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|