C15H14ClN3O2S2 — CID 134118666
3-(4-chlorophenyl)-1-(2-hydroxyethyl)-1-[(E)-(2-oxo-2-thiophen-2-ylethylidene)amino]thiourea (PubChem CID 134118666) has the molecular formula C15H14ClN3O2S2 and a molecular weight of 367.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(2-hydroxyethyl)-1-[(E)-(2-oxo-2-thiophen-2-ylethylidene)amino]thiourea.
| Compound Name | 3-(4-chlorophenyl)-1-(2-hydroxyethyl)-1-[(E)-(2-oxo-2-thiophen-2-ylethylidene)amino]thiourea |
|---|---|
| PubChem CID | 134118666 |
| Molecular Formula | C15H14ClN3O2S2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(2-hydroxyethyl)-1-[(E)-(2-oxo-2-thiophen-2-ylethylidene)amino]thiourea |
| SMILES | O=C(/C=N/N(CCO)C(=S)Nc1ccc(Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C15H14ClN3O2S2/c16-11-3-5-12(6-4-11)18-15(22)19(7-8-20)17-10-13(21)14-2-1-9-23-14/h1-6,9-10,20H,7-8H2,(H,18,22)/b17-10+ |
| InChIKey | UWKHYPOMMIBLPR-LICLKQGHSA-N |
| XLogP | 3.26 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|