2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid

C15H13Cl2NO3 — CID 13409464

IUPAC2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid
SMILESCc1ccc(Oc2cc(Cl)c(Cl)cc2N)c(CC(=O)O)c1
InChIInChI=1S/C15H13Cl2NO3/c1-8-2-3-13(9(4-8)5-15(19)20)21-14-7-11(17)10(16)6-12(14)18/h2-4,6-7H,5,18H2,1H3,(H,19,20)
InChIKeyPMNMWTRQOFRSAJ-UHFFFAOYSA-N
MW326.18 g/mol
LogP4.30
Rot. Bonds4

About 2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid

2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid (PubChem CID 13409464) has the molecular formula C15H13Cl2NO3 and a molecular weight of 326.18 g/mol. Its IUPAC name is 2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid.

Molecular Properties

Compound Name2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid
PubChem CID13409464
Molecular FormulaC15H13Cl2NO3
Molecular Weight326.18 g/mol
Exact Mass325.03
IUPAC Name2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid
SMILESCc1ccc(Oc2cc(Cl)c(Cl)cc2N)c(CC(=O)O)c1
InChIInChI=1S/C15H13Cl2NO3/c1-8-2-3-13(9(4-8)5-15(19)20)21-14-7-11(17)10(16)6-12(14)18/h2-4,6-7H,5,18H2,1H3,(H,19,20)
InChIKeyPMNMWTRQOFRSAJ-UHFFFAOYSA-N
XLogP4.30
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.18
LogP ≤ 54.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid?
The IUPAC name of 2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid (CID 13409464) is 2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid.
What is the SMILES notation for 2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid?
The canonical SMILES for 2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid is Cc1ccc(Oc2cc(Cl)c(Cl)cc2N)c(CC(=O)O)c1.
What is the InChIKey of 2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid?
The InChIKey is PMNMWTRQOFRSAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2NO3/c1-8-2-3-13(9(4-8)5-15(19)20)21-14-7-11(17)10(16)6-12(14)18/h2-4,6-7H,5,18H2,1H3,(H,19,20).
What are the key properties of 2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid?
2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid has a molecular weight of 326.18 g/mol, XLogP of 4.30, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-amino-4,5-dichlorophenoxy)-5-methylphenyl]acetic acid is sourced from PubChem (CID 13409464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).