C14H12FN3O5S2 — CID 134096706
N'-(4-fluorophenyl)sulfonyl-2-(2-nitrophenyl)sulfanylacetohydrazide (PubChem CID 134096706) has the molecular formula C14H12FN3O5S2 and a molecular weight of 385.40 g/mol. Its IUPAC name is N'-(4-fluorophenyl)sulfonyl-2-(2-nitrophenyl)sulfanylacetohydrazide.
| Compound Name | N'-(4-fluorophenyl)sulfonyl-2-(2-nitrophenyl)sulfanylacetohydrazide |
|---|---|
| PubChem CID | 134096706 |
| Molecular Formula | C14H12FN3O5S2 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | N'-(4-fluorophenyl)sulfonyl-2-(2-nitrophenyl)sulfanylacetohydrazide |
| SMILES | O=C(CSc1ccccc1[N+](=O)[O-])NNS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H12FN3O5S2/c15-10-5-7-11(8-6-10)25(22,23)17-16-14(19)9-24-13-4-2-1-3-12(13)18(20)21/h1-8,17H,9H2,(H,16,19) |
| InChIKey | SOHWAMSGVWXFGS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|