C17H19N3O5S2 — CID 2818604
2-(2-nitrophenyl)sulfanyl-N'-(4-propan-2-ylphenyl)sulfonylacetohydrazide (PubChem CID 2818604) has the molecular formula C17H19N3O5S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-(2-nitrophenyl)sulfanyl-N'-(4-propan-2-ylphenyl)sulfonylacetohydrazide.
| Compound Name | 2-(2-nitrophenyl)sulfanyl-N'-(4-propan-2-ylphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 2818604 |
| Molecular Formula | C17H19N3O5S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-(2-nitrophenyl)sulfanyl-N'-(4-propan-2-ylphenyl)sulfonylacetohydrazide |
| SMILES | CC(C)c1ccc(S(=O)(=O)NNC(=O)CSc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H19N3O5S2/c1-12(2)13-7-9-14(10-8-13)27(24,25)19-18-17(21)11-26-16-6-4-3-5-15(16)20(22)23/h3-10,12,19H,11H2,1-2H3,(H,18,21) |
| InChIKey | SBKJGMCNWVEOCO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|