C10H7F4N3S — CID 134098138
4-(2-fluorophenyl)-2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-thione (PubChem CID 134098138) has the molecular formula C10H7F4N3S and a molecular weight of 277.25 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-thione.
| Compound Name | 4-(2-fluorophenyl)-2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 134098138 |
| Molecular Formula | C10H7F4N3S |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 4-(2-fluorophenyl)-2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-thione |
| SMILES | Cn1nc(C(F)(F)F)n(-c2ccccc2F)c1=S |
| InChI | InChI=1S/C10H7F4N3S/c1-16-9(18)17(8(15-16)10(12,13)14)7-5-3-2-4-6(7)11/h2-5H,1H3 |
| InChIKey | OQWSEDIZDFTMLL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|