C23H30ClN5O — CID 134098939
N-[1-[5-(4-chlorophenyl)pyrazolidin-3-yl]piperidin-4-yl]-4-(dimethylamino)benzamide (PubChem CID 134098939) has the molecular formula C23H30ClN5O and a molecular weight of 427.98 g/mol. Its IUPAC name is N-[1-[5-(4-chlorophenyl)pyrazolidin-3-yl]piperidin-4-yl]-4-(dimethylamino)benzamide.
| Compound Name | N-[1-[5-(4-chlorophenyl)pyrazolidin-3-yl]piperidin-4-yl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 134098939 |
| Molecular Formula | C23H30ClN5O |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | N-[1-[5-(4-chlorophenyl)pyrazolidin-3-yl]piperidin-4-yl]-4-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(C(=O)NC2CCN(C3CC(c4ccc(Cl)cc4)NN3)CC2)cc1 |
| InChI | InChI=1S/C23H30ClN5O/c1-28(2)20-9-5-17(6-10-20)23(30)25-19-11-13-29(14-12-19)22-15-21(26-27-22)16-3-7-18(24)8-4-16/h3-10,19,21-22,26-27H,11-15H2,1-2H3,(H,25,30) |
| InChIKey | CTFYKPAAPAKUME-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |