C21H24F2N4O — CID 134098903
2,4-difluoro-N-[1-(5-phenylpyrazolidin-3-yl)piperidin-4-yl]benzamide (PubChem CID 134098903) has the molecular formula C21H24F2N4O and a molecular weight of 386.45 g/mol. Its IUPAC name is 2,4-difluoro-N-[1-(5-phenylpyrazolidin-3-yl)piperidin-4-yl]benzamide.
| Compound Name | 2,4-difluoro-N-[1-(5-phenylpyrazolidin-3-yl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 134098903 |
| Molecular Formula | C21H24F2N4O |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2,4-difluoro-N-[1-(5-phenylpyrazolidin-3-yl)piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C2CC(c3ccccc3)NN2)CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H24F2N4O/c22-15-6-7-17(18(23)12-15)21(28)24-16-8-10-27(11-9-16)20-13-19(25-26-20)14-4-2-1-3-5-14/h1-7,12,16,19-20,25-26H,8-11,13H2,(H,24,28) |
| InChIKey | GXCCBLPJJZJXHH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |