C23H30N4O — CID 134099116
3,5-dimethyl-N-[1-(5-phenylpyrazolidin-3-yl)piperidin-4-yl]benzamide (PubChem CID 134099116) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 3,5-dimethyl-N-[1-(5-phenylpyrazolidin-3-yl)piperidin-4-yl]benzamide.
| Compound Name | 3,5-dimethyl-N-[1-(5-phenylpyrazolidin-3-yl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 134099116 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 3,5-dimethyl-N-[1-(5-phenylpyrazolidin-3-yl)piperidin-4-yl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)NC2CCN(C3CC(c4ccccc4)NN3)CC2)c1 |
| InChI | InChI=1S/C23H30N4O/c1-16-12-17(2)14-19(13-16)23(28)24-20-8-10-27(11-9-20)22-15-21(25-26-22)18-6-4-3-5-7-18/h3-7,12-14,20-22,25-26H,8-11,15H2,1-2H3,(H,24,28) |
| InChIKey | YYGDADKPUVKBGW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |