C20H18ClN3O4 — CID 134099161
2-chloro-N'-(3-hydroxybenzoyl)-4-oxo-1-propylquinoline-3-carbohydrazide (PubChem CID 134099161) has the molecular formula C20H18ClN3O4 and a molecular weight of 399.83 g/mol. Its IUPAC name is 2-chloro-N'-(3-hydroxybenzoyl)-4-oxo-1-propylquinoline-3-carbohydrazide.
| Compound Name | 2-chloro-N'-(3-hydroxybenzoyl)-4-oxo-1-propylquinoline-3-carbohydrazide |
|---|---|
| PubChem CID | 134099161 |
| Molecular Formula | C20H18ClN3O4 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-chloro-N'-(3-hydroxybenzoyl)-4-oxo-1-propylquinoline-3-carbohydrazide |
| SMILES | CCCn1c(Cl)c(C(=O)NNC(=O)c2cccc(O)c2)c(=O)c2ccccc21 |
| InChI | InChI=1S/C20H18ClN3O4/c1-2-10-24-15-9-4-3-8-14(15)17(26)16(18(24)21)20(28)23-22-19(27)12-6-5-7-13(25)11-12/h3-9,11,25H,2,10H2,1H3,(H,22,27)(H,23,28) |
| InChIKey | YZQSSJIIUUXRMT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|