C20H18N4O6 — CID 54686339
4-hydroxy-N'-(2-nitrobenzoyl)-2-oxo-1-propylquinoline-3-carbohydrazide (PubChem CID 54686339) has the molecular formula C20H18N4O6 and a molecular weight of 410.39 g/mol. Its IUPAC name is 4-hydroxy-N'-(2-nitrobenzoyl)-2-oxo-1-propylquinoline-3-carbohydrazide.
| Compound Name | 4-hydroxy-N'-(2-nitrobenzoyl)-2-oxo-1-propylquinoline-3-carbohydrazide |
|---|---|
| PubChem CID | 54686339 |
| Molecular Formula | C20H18N4O6 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 4-hydroxy-N'-(2-nitrobenzoyl)-2-oxo-1-propylquinoline-3-carbohydrazide |
| SMILES | CCCn1c(=O)c(C(=O)NNC(=O)c2ccccc2[N+](=O)[O-])c(O)c2ccccc21 |
| InChI | InChI=1S/C20H18N4O6/c1-2-11-23-14-9-5-3-7-12(14)17(25)16(20(23)28)19(27)22-21-18(26)13-8-4-6-10-15(13)24(29)30/h3-10,25H,2,11H2,1H3,(H,21,26)(H,22,27) |
| InChIKey | UGLWEUBOAPQNJO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 143.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|