C23H27F3N4O2 — CID 134099882
N-[4-amino-6-methyl-5-[3-methyl-3-[4-(trifluoromethyl)phenyl]but-1-ynyl]pyrimidin-2-yl]-4-ethoxybutanamide (PubChem CID 134099882) has the molecular formula C23H27F3N4O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is N-[4-amino-6-methyl-5-[3-methyl-3-[4-(trifluoromethyl)phenyl]but-1-ynyl]pyrimidin-2-yl]-4-ethoxybutanamide.
| Compound Name | N-[4-amino-6-methyl-5-[3-methyl-3-[4-(trifluoromethyl)phenyl]but-1-ynyl]pyrimidin-2-yl]-4-ethoxybutanamide |
|---|---|
| PubChem CID | 134099882 |
| Molecular Formula | C23H27F3N4O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-[4-amino-6-methyl-5-[3-methyl-3-[4-(trifluoromethyl)phenyl]but-1-ynyl]pyrimidin-2-yl]-4-ethoxybutanamide |
| SMILES | CCOCCCC(=O)Nc1nc(C)c(C#CC(C)(C)c2ccc(C(F)(F)F)cc2)c(N)n1 |
| InChI | InChI=1S/C23H27F3N4O2/c1-5-32-14-6-7-19(31)29-21-28-15(2)18(20(27)30-21)12-13-22(3,4)16-8-10-17(11-9-16)23(24,25)26/h8-11H,5-7,14H2,1-4H3,(H3,27,28,29,30,31) |
| InChIKey | RVCNNEFMDLGSGM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|