C27H31ClN2O6 — CID 134103891
2-(2-chlorophenyl)-1,3-bis(3,4,5-trimethoxyphenyl)imidazolidine (PubChem CID 134103891) has the molecular formula C27H31ClN2O6 and a molecular weight of 515.01 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1,3-bis(3,4,5-trimethoxyphenyl)imidazolidine.
| Compound Name | 2-(2-chlorophenyl)-1,3-bis(3,4,5-trimethoxyphenyl)imidazolidine |
|---|---|
| PubChem CID | 134103891 |
| Molecular Formula | C27H31ClN2O6 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 2-(2-chlorophenyl)-1,3-bis(3,4,5-trimethoxyphenyl)imidazolidine |
| SMILES | COc1cc(N2CCN(c3cc(OC)c(OC)c(OC)c3)C2c2ccccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C27H31ClN2O6/c1-31-21-13-17(14-22(32-2)25(21)35-5)29-11-12-30(27(29)19-9-7-8-10-20(19)28)18-15-23(33-3)26(36-6)24(16-18)34-4/h7-10,13-16,27H,11-12H2,1-6H3 |
| InChIKey | PRTVAEZWFBQDQH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|