C19H23NO4 — CID 102233510
[(4S)-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-4-yl]methanol (PubChem CID 102233510) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is [(4S)-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-4-yl]methanol.
| Compound Name | [(4S)-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-4-yl]methanol |
|---|---|
| PubChem CID | 102233510 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [(4S)-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-1H-isoquinolin-4-yl]methanol |
| SMILES | COc1cc(N2Cc3ccccc3[C@H](CO)C2)cc(OC)c1OC |
| InChI | InChI=1S/C19H23NO4/c1-22-17-8-15(9-18(23-2)19(17)24-3)20-10-13-6-4-5-7-16(13)14(11-20)12-21/h4-9,14,21H,10-12H2,1-3H3/t14-/m0/s1 |
| InChIKey | MARJXGABOJCUQI-AWEZNQCLSA-N |
| XLogP | 2.81 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|