C17H20N2O4 — CID 14989697
6-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-dihydropyrrolo[3,4-c]pyridin-7-ol (PubChem CID 14989697) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 6-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-dihydropyrrolo[3,4-c]pyridin-7-ol.
| Compound Name | 6-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-dihydropyrrolo[3,4-c]pyridin-7-ol |
|---|---|
| PubChem CID | 14989697 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 6-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-dihydropyrrolo[3,4-c]pyridin-7-ol |
| SMILES | COc1cc(N2Cc3cnc(C)c(O)c3C2)cc(OC)c1OC |
| InChI | InChI=1S/C17H20N2O4/c1-10-16(20)13-9-19(8-11(13)7-18-10)12-5-14(21-2)17(23-4)15(6-12)22-3/h5-7,20H,8-9H2,1-4H3 |
| InChIKey | DDJJKQXVGWCZGO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|