C6H9ClN6 — CID 134106493
N'-(4-amino-6-chloro-1,3,5-triazin-2-yl)-N,N-dimethylmethanimidamide (PubChem CID 134106493) has the molecular formula C6H9ClN6 and a molecular weight of 200.63 g/mol. Its IUPAC name is N'-(4-amino-6-chloro-1,3,5-triazin-2-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(4-amino-6-chloro-1,3,5-triazin-2-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 134106493 |
| Molecular Formula | C6H9ClN6 |
| Molecular Weight | 200.63 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N'-(4-amino-6-chloro-1,3,5-triazin-2-yl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1nc(N)nc(Cl)n1 |
| InChI | InChI=1S/C6H9ClN6/c1-13(2)3-9-6-11-4(7)10-5(8)12-6/h3H,1-2H3,(H2,8,10,11,12)/b9-3+ |
| InChIKey | OWPBXPPTZNAFBL-YCRREMRBSA-N |
| XLogP | 0.33 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.63 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|